CAS 1641033-82-0 is the registry number for (R)-2-Amino-2-(1,4-dimethyl-1H-pyrazol-5-yl)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-(1,4-dimethylpyrazol-5-yl)ethanol (CAS 1641033-82-0) is a chemical compound with the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. IUPAC name: (2R)-2-amino-2-(1,4-dimethylpyrazol-5-yl)ethanol. InChIKey: ZXOOJSTXRPRJKW-LURJTMIESA-N.
| Molecular formula | C7H13N3O |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | (2R)-2-amino-2-(1,4-dimethylpyrazol-5-yl)ethanol |
| InChIKey | ZXOOJSTXRPRJKW-LURJTMIESA-N |
| SMILES | CC1=C(N(N=C1)C)[C@H](CO)N |
Computed by PubChem (NCBI)