Products 164112-72-5
CAS 164112-72-5 is the registry number for alpha,alpha,alpha-Trifluorotoluene-d5, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,3,4,5-pentadeuterio-6-(trifluoromethyl)benzene (CAS 164112-72-5) is a chemical compound with the molecular formula C7H5F3 and a molecular weight of 151.14 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(trifluoromethyl)benzene. InChIKey: GETTZEONDQJALK-RALIUCGRSA-N.
| Molecular formula | C7H5F3 |
|---|---|
| Molecular weight | 151.14 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(trifluoromethyl)benzene |
| InChIKey | GETTZEONDQJALK-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)