CAS 16416-22-1 is the registry number for (E)-2-Furaldehyde, (2,4-Dinitrophenyl)hydrazone. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
N-[(E)-furan-2-ylmethylideneamino]-2,4-dinitroaniline (CAS 16416-22-1) is a chemical compound with the molecular formula C11H8N4O5 and a molecular weight of 276.20 g/mol. IUPAC name: N-[(E)-furan-2-ylmethylideneamino]-2,4-dinitroaniline. InChIKey: JLMSXDMAAIAPCZ-KPKJPENVSA-N.
| Molecular formula | C11H8N4O5 |
|---|---|
| Molecular weight | 276.20 g/mol |
| IUPAC name | N-[(E)-furan-2-ylmethylideneamino]-2,4-dinitroaniline |
| InChIKey | JLMSXDMAAIAPCZ-KPKJPENVSA-N |
| SMILES | C1=COC(=C1)/C=N/NC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)