Products 16416-29-8
CAS 16416-29-8 appears in our catalog under these names: N-Decane-d22, n-Decane-d22, 98 atom % D, min 98% Chemical Purity, n-Decane-D22 99 atom % D, DECANE-D22, 99 ATOM % D. Offered by: TRC, CDN, Deutero, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 50mg, 5g, 1g, 0,7ml, 5ml.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-docosadeuteriodecane (CAS 16416-29-8) is a chemical compound with the molecular formula C10H22 and a molecular weight of 164.42 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-docosadeuteriodecane. InChIKey: DIOQZVSQGTUSAI-DNYWURFXSA-N.
| Molecular formula | C10H22 |
|---|---|
| Molecular weight | 164.42 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-docosadeuteriodecane |
| InChIKey | DIOQZVSQGTUSAI-DNYWURFXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)