CAS 16416-30-1 appears in our catalog under these names: N-Dodecane-d26, 95%, Dodecane-d26, n-Dodecane-d26, 98 atom % D, min 98% Chemical Purity, dodecane–D26, DODECANE-D26, 98 ATOM % D. Offered by: Combi-blocks, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 100mg, 10mM (in 1ml dmso), 250 mg, 10mM/1mL, 100 mg.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane (CAS 16416-30-1) is a chemical compound with the molecular formula C12H26 and a molecular weight of 196.49 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane. InChIKey: SNRUBQQJIBEYMU-DWXHPOBZSA-N.
| Molecular formula | C12H26 |
|---|---|
| Molecular weight | 196.49 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane |
| InChIKey | SNRUBQQJIBEYMU-DWXHPOBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)