CAS 164162-36-1 appears in our catalog under these names: 2-((tert-butyldimethylsilyl)oxy)ethyl trifluoromethanesulfonate, Everolimus Impurity 12, 2-((tert-Butyl)dimethylsiloxy)ethyl Triflate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
2-[tert-butyl(dimethyl)silyl]oxyethyl trifluoromethanesulfonate (CAS 164162-36-1) is a chemical compound with the molecular formula C9H19F3O4SSi and a molecular weight of 308.39 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxyethyl trifluoromethanesulfonate. InChIKey: DUUWFQBUGWHIMO-UHFFFAOYSA-N.
| Molecular formula | C9H19F3O4SSi |
|---|---|
| Molecular weight | 308.39 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxyethyl trifluoromethanesulfonate |
| InChIKey | DUUWFQBUGWHIMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)