CAS 164298-23-1 appears in our catalog under these names: TFFH, Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophosphat, Fluoro-N,N,N',N'-tetramethylformamidinium Hexafluorophosphate, >97.0%(N), TFFH 95%, FLUORO-N,N,N',N'-TETRAMETHYLFORMAMIDINI&. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 5g, 25g, 0,05kg, 0,025kg, 0,1kg, 0,25kg, 0,5kg.
[dimethylamino(fluoro)methylidene]-dimethylazanium hexafluorophosphate (CAS 164298-23-1) is a chemical compound with the molecular formula C5H12F7N2P and a molecular weight of 264.12 g/mol. IUPAC name: [dimethylamino(fluoro)methylidene]-dimethylazanium hexafluorophosphate. InChIKey: ZAVXOOLKAGPJPI-UHFFFAOYSA-N.
| Molecular formula | C5H12F7N2P |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | [dimethylamino(fluoro)methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | ZAVXOOLKAGPJPI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)