CAS 1643-73-8 appears in our catalog under these names: 4-Fluorobenzylmagnesium chloride, 0.25M solution in THF, AcroSeal®, 4-FLUOROBENZYLMAGNESIUM CHLORIDE, 0.25M&. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 50ML.
Magnesium;1-fluoro-4-methanidylbenzene;chloride (CAS 1643-73-8) is a chemical compound with the molecular formula C7H6ClFMg and a molecular weight of 168.88 g/mol. IUPAC name: magnesium;1-fluoro-4-methanidylbenzene;chloride. InChIKey: JHMNJUQVLPODJN-UHFFFAOYSA-M.
| Molecular formula | C7H6ClFMg |
|---|---|
| Molecular weight | 168.88 g/mol |
| IUPAC name | magnesium;1-fluoro-4-methanidylbenzene;chloride |
| InChIKey | JHMNJUQVLPODJN-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC=C(C=C1)F.[Mg+2].[Cl-] |
Computed by PubChem (NCBI)