CAS 1643413-83-5 is the registry number for Ticagrelor Impurity 153. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine (CAS 1643413-83-5) is a chemical compound with the molecular formula C9H9F2N and a molecular weight of 169.17 g/mol. IUPAC name: trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine. InChIKey: VGOOBWCLQZIMCR-IONNQARKSA-N.
| Molecular formula | C9H9F2N |
|---|---|
| Molecular weight | 169.17 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2,4-difluorophenyl)cyclopropan-1-amine |
| InChIKey | VGOOBWCLQZIMCR-IONNQARKSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)