CAS 1643440-91-8 is the registry number for 3-BROMO-N'-HYDROXYBENZENECARBOXIMIDAMIDE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
3-bromo-N'-hydroxybenzenecarboximidamide (CAS 1643440-91-8) is a chemical compound with the molecular formula C7H7BrN2O and a molecular weight of 215.05 g/mol. IUPAC name: 3-bromo-N'-hydroxybenzenecarboximidamide. InChIKey: NQFJSTMFTXNUKP-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O |
|---|---|
| Molecular weight | 215.05 g/mol |
| IUPAC name | 3-bromo-N'-hydroxybenzenecarboximidamide |
| InChIKey | NQFJSTMFTXNUKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)/C(=N/O)/N |
Computed by PubChem (NCBI)