CAS 1643463-59-5 is the registry number for KIO-301 (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium chloride (CAS 1643463-59-5) is a chemical compound with the molecular formula C29H38ClN5O and a molecular weight of 508.1 g/mol. IUPAC name: [2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium chloride. InChIKey: IQGPOKDZMRDQDZ-UHFFFAOYSA-N.
| Molecular formula | C29H38ClN5O |
|---|---|
| Molecular weight | 508.1 g/mol |
| IUPAC name | [2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium chloride |
| InChIKey | IQGPOKDZMRDQDZ-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=CC=C1)C2=CC=C(C=C2)N=NC3=CC=C(C=C3)NC(=O)C[N+](CC)(CC)CC.[Cl-] |
Computed by PubChem (NCBI)