CAS 1643463-61-9 is the registry number for KIO-301. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium bromide (CAS 1643463-61-9) is a chemical compound with the molecular formula C29H38BrN5O and a molecular weight of 552.5 g/mol. IUPAC name: [2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium bromide. InChIKey: JDJYAEQQVWPYBU-UHFFFAOYSA-N.
| Molecular formula | C29H38BrN5O |
|---|---|
| Molecular weight | 552.5 g/mol |
| IUPAC name | [2-[4-[[4-[benzyl(ethyl)amino]phenyl]diazenyl]anilino]-2-oxoethyl]-triethylazanium bromide |
| InChIKey | JDJYAEQQVWPYBU-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=CC=C1)C2=CC=C(C=C2)N=NC3=CC=C(C=C3)NC(=O)C[N+](CC)(CC)CC.[Br-] |
Computed by PubChem (NCBI)