CAS 1643468-66-9 appears in our catalog under these names: (2S,4S)-1-(tert-Butoxycarbonyl)-4-(hydroxymethyl)pyrrolidine-2-carboxylic acid, 98%, 1,2-Pyrrolidinedicarboxylic acid, 4-(hydroxymethyl)-, 1-(1,1-dimethylethyl) ester, (2S,4S)-, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g.
(2S,4S)-4-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1643468-66-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S,4S)-4-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: CUBONVNGPJTNOO-YUMQZZPRSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S,4S)-4-(hydroxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CUBONVNGPJTNOO-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)CO |
Computed by PubChem (NCBI)