Products 1643543-71-8
CAS 1643543-71-8 is the registry number for 2-Trifluoromethylaminobenzene-3,4,5,6-D4. Offered by: TRC. Available pack sizes: 50mg.
2,3,4,5-tetradeuterio-6-(trifluoromethyl)aniline (CAS 1643543-71-8) is a chemical compound with the molecular formula C7H6F3N and a molecular weight of 165.15 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(trifluoromethyl)aniline. InChIKey: VBLXCTYLWZJBKA-RHQRLBAQSA-N.
| Molecular formula | C7H6F3N |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(trifluoromethyl)aniline |
| InChIKey | VBLXCTYLWZJBKA-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(F)(F)F)N)[2H])[2H] |
Computed by PubChem (NCBI)