CAS 1643564-99-1 is the registry number for 2-Bromoaniline-d4. Offered by: TRC. Available pack sizes: 25mg.
2-bromo-3,4,5,6-tetradeuterioaniline (CAS 1643564-99-1) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 176.05 g/mol. IUPAC name: 2-bromo-3,4,5,6-tetradeuterioaniline. InChIKey: AOPBDRUWRLBSDB-RHQRLBAQSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 176.05 g/mol |
| IUPAC name | 2-bromo-3,4,5,6-tetradeuterioaniline |
| InChIKey | AOPBDRUWRLBSDB-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)Br)[2H])[2H] |
Computed by PubChem (NCBI)