CAS 1643571-10-1 is the registry number for 3-(Benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1643571-10-1) is a chemical compound with the molecular formula C19H24BNO3 and a molecular weight of 325.2 g/mol. IUPAC name: 3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: NXFIDVUVPAXKCS-UHFFFAOYSA-N.
| Molecular formula | C19H24BNO3 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | 3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | NXFIDVUVPAXKCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)