Products 1643616-33-4
CAS 1643616-33-4 is the registry number for 1-Methyl 2-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)ethanedioate. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
1-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) oxalate (CAS 1643616-33-4) is a chemical compound with the molecular formula C13H10O6 and a molecular weight of 262.21 g/mol. IUPAC name: 1-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) oxalate. InChIKey: PNBPWQZBKMMJDL-UHFFFAOYSA-N.
| Molecular formula | C13H10O6 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | 1-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) oxalate |
| InChIKey | PNBPWQZBKMMJDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC(=O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-methyl-2-oxo-2H-chromen-7-yl oxalate, Methyl (4-methyl-2-oxo-2H-chromen-7-yl) oxalate, 1-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) oxalate, Chemodosimeter 1, starbld0009997, orb1697843, O1-methyl O2-(4-methyl-2-oxo-chromen-7-yl) oxalate, 1-Methyl 2-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)ethanedioate