Products 1643773-11-8

CAS 1643773-11-8 is the registry number for 14-Hydroxy-6,9,12-trioxa-2-azatetradecanoic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]carbamate (CAS 1643773-11-8) is a chemical compound with the molecular formula C14H29NO6 and a molecular weight of 307.38 g/mol. IUPAC name: tert-butyl N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]carbamate. InChIKey: LRPRGSISFTZFAG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H29NO6
Molecular weight307.38 g/mol
IUPAC nametert-butyl N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propyl]carbamate
InChIKeyLRPRGSISFTZFAG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCOCCOCCOCCO

Computed by PubChem (NCBI)