Products 1643781-40-1
CAS 1643781-40-1 is the registry number for SPD-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-carboxy-2-(9-oxoxanthen-2-yl)propyl]sulfanyl-2-methyl-2-(9-oxoxanthen-2-yl)propanoic acid (CAS 1643781-40-1) is a chemical compound with the molecular formula C34H26O8S and a molecular weight of 594.6 g/mol. IUPAC name: 3-[2-carboxy-2-(9-oxoxanthen-2-yl)propyl]sulfanyl-2-methyl-2-(9-oxoxanthen-2-yl)propanoic acid. InChIKey: HLYJZNLEINAZNN-UHFFFAOYSA-N.
| Molecular formula | C34H26O8S |
|---|---|
| Molecular weight | 594.6 g/mol |
| IUPAC name | 3-[2-carboxy-2-(9-oxoxanthen-2-yl)propyl]sulfanyl-2-methyl-2-(9-oxoxanthen-2-yl)propanoic acid |
| InChIKey | HLYJZNLEINAZNN-UHFFFAOYSA-N |
| SMILES | CC(CSCC(C)(C1=CC2=C(C=C1)OC3=CC=CC=C3C2=O)C(=O)O)(C4=CC5=C(C=C4)OC6=CC=CC=C6C5=O)C(=O)O |
Computed by PubChem (NCBI)