CAS 1643878-69-6 is the registry number for (1,1'–bi(cyclopropan))–2–ylboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[(1R,2R)-2-cyclopropylcyclopropyl]boronic acid (CAS 1643878-69-6) is a chemical compound with the molecular formula C6H11BO2 and a molecular weight of 125.96 g/mol. IUPAC name: [(1R,2R)-2-cyclopropylcyclopropyl]boronic acid. InChIKey: CMOQQAREPWVZAP-NTSWFWBYSA-N.
| Molecular formula | C6H11BO2 |
|---|---|
| Molecular weight | 125.96 g/mol |
| IUPAC name | [(1R,2R)-2-cyclopropylcyclopropyl]boronic acid |
| InChIKey | CMOQQAREPWVZAP-NTSWFWBYSA-N |
| SMILES | B([C@@H]1C[C@H]1C2CC2)(O)O |
Computed by PubChem (NCBI)