CAS 1643958-85-3 appears in our catalog under these names: RS1-PDK1 inhibitor/ 98.25% (existing batch purity), PDK1–IN–2, N-(6-chloro-1,3-benzothiazol-2-yl)-1-benzothiophene-3-sulfonamide, PDK1-IN-2, 98.90%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
N-(6-chloro-1,3-benzothiazol-2-yl)-1-benzothiophene-3-sulfonamide (CAS 1643958-85-3) is a chemical compound with the molecular formula C15H9ClN2O2S3 and a molecular weight of 380.9 g/mol. IUPAC name: N-(6-chloro-1,3-benzothiazol-2-yl)-1-benzothiophene-3-sulfonamide. InChIKey: VLGMTYRMKMVUHJ-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O2S3 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | N-(6-chloro-1,3-benzothiazol-2-yl)-1-benzothiophene-3-sulfonamide |
| InChIKey | VLGMTYRMKMVUHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)S(=O)(=O)NC3=NC4=C(S3)C=C(C=C4)Cl |
Computed by PubChem (NCBI)