CAS 164396-23-0 is the registry number for 2,2-Bis(4-aminophenyl)adamantane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2-(4-aminophenyl)-2-adamantyl]aniline (CAS 164396-23-0) is a chemical compound with the molecular formula C22H26N2 and a molecular weight of 318.5 g/mol. IUPAC name: 4-[2-(4-aminophenyl)-2-adamantyl]aniline. InChIKey: SIRBJVCEJWRRJT-UHFFFAOYSA-N.
| Molecular formula | C22H26N2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)-2-adamantyl]aniline |
| InChIKey | SIRBJVCEJWRRJT-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C3(C4=CC=C(C=C4)N)C5=CC=C(C=C5)N |
Computed by PubChem (NCBI)