CAS 1643967-75-2 is the registry number for (2,4-Dichloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl)methyl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate (CAS 1643967-75-2) is a chemical compound with the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.15 g/mol. IUPAC name: (2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate. InChIKey: LXGGFKUNPSZFOR-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N3O2 |
|---|---|
| Molecular weight | 302.15 g/mol |
| IUPAC name | (2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate |
| InChIKey | LXGGFKUNPSZFOR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCN1C=CC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)