Products 1644251-34-2
CAS 1644251-34-2 is the registry number for Diethyl 2-((1R,5S,6R)-6-cyano-3-ethylbicyclo[3.2.0]hept-3-en-6-yl)malonate, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Diethyl 2-[(1R,5S,6R)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate (CAS 1644251-34-2) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: diethyl 2-[(1R,5S,6R)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate. InChIKey: SYSGISWTBLIKFO-PBFPGSCMSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | diethyl 2-[(1R,5S,6R)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate |
| InChIKey | SYSGISWTBLIKFO-PBFPGSCMSA-N |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@]2(C#N)C(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)