CAS 1644281-87-7 appears in our catalog under these names: 6-Bromo-3,4-difluoro-2-nitrophenol, 95%, 6-Bromo-3,4-difluoro-2-nitrophenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
6-bromo-3,4-difluoro-2-nitrophenol (CAS 1644281-87-7) is a chemical compound with the molecular formula C6H2BrF2NO3 and a molecular weight of 253.99 g/mol. IUPAC name: 6-bromo-3,4-difluoro-2-nitrophenol. InChIKey: CGGFDLQNYKVWJN-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO3 |
|---|---|
| Molecular weight | 253.99 g/mol |
| IUPAC name | 6-bromo-3,4-difluoro-2-nitrophenol |
| InChIKey | CGGFDLQNYKVWJN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)