CAS 1644398-13-9 is the registry number for H-L-Sec(oNv)-OH*TFA. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
(2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylselanyl]propanoic acid;2,2,2-trifluoroacetic acid (CAS 1644398-13-9) is a chemical compound with the molecular formula C14H17F3N2O8Se and a molecular weight of 477.26 g/mol. IUPAC name: (2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylselanyl]propanoic acid;2,2,2-trifluoroacetic acid. InChIKey: CLNGLAJWNQNGMJ-QRPNPIFTSA-N.
| Molecular formula | C14H17F3N2O8Se |
|---|---|
| Molecular weight | 477.26 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methylselanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | CLNGLAJWNQNGMJ-QRPNPIFTSA-N |
| SMILES | COC1=C(C=C(C(=C1)C[Se]C[C@@H](C(=O)O)N)[N+](=O)[O-])OC.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)