CAS 1644443-92-4 appears in our catalog under these names: GW406108X, 98%, GW406108X, GW406108X, ≥98%, ≥98%, GW406108X, 98.0%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 2mg, 1mg.
(3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one (CAS 1644443-92-4) is a chemical compound with the molecular formula C20H11Cl2NO4 and a molecular weight of 400.2 g/mol. IUPAC name: (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one. InChIKey: XKTUKRBLWOHYIL-MLPAPPSSSA-N.
| Molecular formula | C20H11Cl2NO4 |
|---|---|
| Molecular weight | 400.2 g/mol |
| IUPAC name | (3Z)-3-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-5-(furan-2-carbonyl)-1H-indol-2-one |
| InChIKey | XKTUKRBLWOHYIL-MLPAPPSSSA-N |
| SMILES | C1=COC(=C1)C(=O)C2=CC\3=C(C=C2)NC(=O)/C3=C\C4=CC(=C(C(=C4)Cl)O)Cl |
Computed by PubChem (NCBI)