CAS 1644451-34-2 appears in our catalog under these names: 3-Indoxyl Sulfate-d5 Potassium Salt, >95% (HPLC), Indoxyl Sulfate–d5 (potassium salt), 3-Indoxyl Sulfate-d5 (potassium), 99.77%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 1mg, 5mg, 2.5 mg.
Potassium (2,4,5,6,7-pentadeuterio-1H-indol-3-yl) sulfate (CAS 1644451-34-2) is a chemical compound with the molecular formula C8H6KNO4S and a molecular weight of 256.33 g/mol. IUPAC name: potassium (2,4,5,6,7-pentadeuterio-1H-indol-3-yl) sulfate. InChIKey: MDAWATNFDJIBBD-GWVWGMRQSA-M.
| Molecular formula | C8H6KNO4S |
|---|---|
| Molecular weight | 256.33 g/mol |
| IUPAC name | potassium (2,4,5,6,7-pentadeuterio-1H-indol-3-yl) sulfate |
| InChIKey | MDAWATNFDJIBBD-GWVWGMRQSA-M |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])OS(=O)(=O)[O-])[2H])[2H].[K+] |
Computed by PubChem (NCBI)