CAS 1644464-87-8 appears in our catalog under these names: Methyl 2-hydroxy-3-iodo-5-nitrobenzoate, 98%, Methyl 2-hydroxy-3-iodo-5-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 2-hydroxy-3-iodo-5-nitrobenzoate (CAS 1644464-87-8) is a chemical compound with the molecular formula C8H6INO5 and a molecular weight of 323.04 g/mol. IUPAC name: methyl 2-hydroxy-3-iodo-5-nitrobenzoate. InChIKey: TYXZFXVSRQYVPR-UHFFFAOYSA-N.
| Molecular formula | C8H6INO5 |
|---|---|
| Molecular weight | 323.04 g/mol |
| IUPAC name | methyl 2-hydroxy-3-iodo-5-nitrobenzoate |
| InChIKey | TYXZFXVSRQYVPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)[N+](=O)[O-])I)O |
Computed by PubChem (NCBI)