CAS 1644529-01-0 appears in our catalog under these names: 1-(Trifluoromethyl)-1,2-hydrazinedicarboxylic Acid 1,2-Bis(1,1-dimethylethyl) Ester, Di-tert-butyl 1-(trifluoromethyl)hydrazine-1,2-dicarboxylate, 97%, 97%, Di-tert-butyl 1-(trifluoromethyl)hydrazine-1,2-dicarboxylate, 97%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 50mg, 5mg, 250mg, 1g, 5g.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(trifluoromethyl)carbamate (CAS 1644529-01-0) is a chemical compound with the molecular formula C11H19F3N2O4 and a molecular weight of 300.27 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(trifluoromethyl)carbamate. InChIKey: WCGXDMBPSBDJBB-UHFFFAOYSA-N.
| Molecular formula | C11H19F3N2O4 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(trifluoromethyl)carbamate |
| InChIKey | WCGXDMBPSBDJBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)