CAS 1644541-87-6 is the registry number for 4,4,5,5-Tetramethyl-2-(4-tricyclo[3.3.1.13,7]dec-1-ylphenyl)-1,3,2-dioxaborolane, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-[4-(1-adamantyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1644541-87-6) is a chemical compound with the molecular formula C22H31BO2 and a molecular weight of 338.3 g/mol. IUPAC name: 2-[4-(1-adamantyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NCZDRZONSOHMPI-UHFFFAOYSA-N.
| Molecular formula | C22H31BO2 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 2-[4-(1-adamantyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NCZDRZONSOHMPI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C34CC5CC(C3)CC(C5)C4 |
Computed by PubChem (NCBI)