CAS 1644566-39-1 appears in our catalog under these names: Letrozole Diacid Impurity, >95% (HPLC), 4,4'-(1H-1,2,4-Triazol-1-ylmethylene)dibenzoic Acid, 4,4'–(1H–1,2,4–Triazol–1–ylmethylene)bis(benzoic acid), 4,4'-((1H-1,2,4-Triazol-1-yl)methylene)dibenzoic acid, 95%, 95%. Offered by: TRC, Mikromol, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 250mg.
4-[(4-carboxyphenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid (CAS 1644566-39-1) is a chemical compound with the molecular formula C17H13N3O4 and a molecular weight of 323.30 g/mol. IUPAC name: 4-[(4-carboxyphenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid. InChIKey: OMYQMDBEDMTHOJ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O4 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)-(1,2,4-triazol-1-yl)methyl]benzoic acid |
| InChIKey | OMYQMDBEDMTHOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)C(=O)O)N3C=NC=N3)C(=O)O |
Computed by PubChem (NCBI)