CAS 164461-18-1 appears in our catalog under these names: PYRENE-1-BORONIC ACID, Pyrene-1-boronic acid, 95% , Pyrene-1-boronic acid 97%, PYRENE-1-BORONIC ACID, >=95.0%, 1-Pyreneboronic acid, 97%, 97%. Offered by: Sigma-Aldrich, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1G, 5g, 250mg, 10g, 25g, 100g, 500g, 50g.
Pyren-1-ylboronic acid (CAS 164461-18-1) is a chemical compound with the molecular formula C16H11BO2 and a molecular weight of 246.1 g/mol. IUPAC name: pyren-1-ylboronic acid. InChIKey: MWEKPLLMFXIZOC-UHFFFAOYSA-N.
| Molecular formula | C16H11BO2 |
|---|---|
| Molecular weight | 246.1 g/mol |
| IUPAC name | pyren-1-ylboronic acid |
| InChIKey | MWEKPLLMFXIZOC-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC3=CC=CC4=C3C2=C(C=C1)C=C4)(O)O |
Computed by PubChem (NCBI)