CAS 1644679-78-6 appears in our catalog under these names: (3,3-Difluorocyclopentyl)methyl methanesulfonate, 95%, (3,3-Difluorocyclopentyl)methyl methanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3,3-difluorocyclopentyl)methyl methanesulfonate (CAS 1644679-78-6) is a chemical compound with the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. IUPAC name: (3,3-difluorocyclopentyl)methyl methanesulfonate. InChIKey: DLQPBMXHHDMBCA-UHFFFAOYSA-N.
| Molecular formula | C7H12F2O3S |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (3,3-difluorocyclopentyl)methyl methanesulfonate |
| InChIKey | DLQPBMXHHDMBCA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1CCC(C1)(F)F |
Computed by PubChem (NCBI)