CAS 1645-67-6 appears in our catalog under these names: 2,4-Dinitro-1-(1,1,2,2-tetrafluoroethoxy)benzene, 95%, 2,4-Dinitro-1-(1,1,2,2-tetrafluoroethoxy)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
2,4-dinitro-1-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 1645-67-6) is a chemical compound with the molecular formula C8H4F4N2O5 and a molecular weight of 284.12 g/mol. IUPAC name: 2,4-dinitro-1-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: PPEJTWQARACQTQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2O5 |
|---|---|
| Molecular weight | 284.12 g/mol |
| IUPAC name | 2,4-dinitro-1-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | PPEJTWQARACQTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OC(C(F)F)(F)F |
Computed by PubChem (NCBI)