Products 1645286-75-4
CAS 1645286-75-4 appears in our catalog under these names: Az6102, 95%, AZ6102, 98%, AZ6102/ 99.91% (existing batch purity), AZ6102, AZ 6102. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 5mg, 2mg, 10mg, 25mg, 50mg, 250mg, 25 mg.
2-[4-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-methyl-3-pyridinyl]phenyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 1645286-75-4) is a chemical compound with the molecular formula C25H28N6O and a molecular weight of 428.5 g/mol. IUPAC name: 2-[4-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-methyl-3-pyridinyl]phenyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: WCPTUQOMNJBIET-CALCHBBNSA-N.
| Molecular formula | C25H28N6O |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 2-[4-[6-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-4-methyl-3-pyridinyl]phenyl]-7-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | WCPTUQOMNJBIET-CALCHBBNSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=NC=C(C(=C2)C)C3=CC=C(C=C3)C4=NC5=C(C=CN5C)C(=O)N4 |
Computed by PubChem (NCBI)