CAS 164595-81-7 is the registry number for Torasemide Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-methylanilino)pyridine-3-sulfonamide (CAS 164595-81-7) is a chemical compound with the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. IUPAC name: 4-(4-methylanilino)pyridine-3-sulfonamide. InChIKey: UZBFRCRILFIALS-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2S |
|---|---|
| Molecular weight | 263.32 g/mol |
| IUPAC name | 4-(4-methylanilino)pyridine-3-sulfonamide |
| InChIKey | UZBFRCRILFIALS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=NC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)