CAS 16462-88-7 appears in our catalog under these names: ((3-Bromo-2,2-dimethylpropyl)sulfonyl)benzene, 97%, (3-Bromo-2,2-dimethylpropanesulfonyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3-bromo-2,2-dimethylpropyl)sulfonylbenzene (CAS 16462-88-7) is a chemical compound with the molecular formula C11H15BrO2S and a molecular weight of 291.21 g/mol. IUPAC name: (3-bromo-2,2-dimethylpropyl)sulfonylbenzene. InChIKey: BVMTWZWMNBNTFI-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO2S |
|---|---|
| Molecular weight | 291.21 g/mol |
| IUPAC name | (3-bromo-2,2-dimethylpropyl)sulfonylbenzene |
| InChIKey | BVMTWZWMNBNTFI-UHFFFAOYSA-N |
| SMILES | CC(C)(CS(=O)(=O)C1=CC=CC=C1)CBr |
Computed by PubChem (NCBI)