CAS 1646272-69-6 is the registry number for N-[1,1'-Biphenyl]-4-ylbenzo[b]naphtho[1,2-d]furan-9-amine, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.
N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-9-amine (CAS 1646272-69-6) is a chemical compound with the molecular formula C28H19NO and a molecular weight of 385.5 g/mol. IUPAC name: N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-9-amine. InChIKey: SHSWHHCGEONZKK-UHFFFAOYSA-N.
| Molecular formula | C28H19NO |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | N-(4-phenylphenyl)naphtho[2,1-b][1]benzofuran-9-amine |
| InChIKey | SHSWHHCGEONZKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC4=C(C=C3)C5=C(O4)C=CC6=CC=CC=C65 |
Computed by PubChem (NCBI)