CAS 1646313-44-1 is the registry number for 1,3-Dibromo-5-(4-fluorobenzyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1,3-dibromo-5-[(4-fluorophenyl)methyl]benzene (CAS 1646313-44-1) is a chemical compound with the molecular formula C13H9Br2F and a molecular weight of 344.02 g/mol. IUPAC name: 1,3-dibromo-5-[(4-fluorophenyl)methyl]benzene. InChIKey: UQJNPKMBJAKHNJ-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2F |
|---|---|
| Molecular weight | 344.02 g/mol |
| IUPAC name | 1,3-dibromo-5-[(4-fluorophenyl)methyl]benzene |
| InChIKey | UQJNPKMBJAKHNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC(=CC(=C2)Br)Br)F |
Computed by PubChem (NCBI)