CAS 1646317-05-6 is the registry number for Ethyl 5-methyl-2-(4-(trifluoromethoxy)phenyl)oxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxylate (CAS 1646317-05-6) is a chemical compound with the molecular formula C14H12F3NO4 and a molecular weight of 315.24 g/mol. IUPAC name: ethyl 5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxylate. InChIKey: ABBQDAQTXJQEDL-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO4 |
|---|---|
| Molecular weight | 315.24 g/mol |
| IUPAC name | ethyl 5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxylate |
| InChIKey | ABBQDAQTXJQEDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=C(C=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)