CAS 1646321-63-2 appears in our catalog under these names: Iptacopan HCl, 98%, Iptacopan hydrochloride, Iptacopan hydrochloride/ 99.84% (existing batch purity), Iptacopan hydrochloride, Iptacopan HCl 98%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 250mg.
Iptacopan hydrochloride is the hydrochloride salt of iptacopan. It has a role as a complement factor B inhibitor and an immunomodulator. It contains an iptacopan(1+).
Source: ChEBI
| Molecular formula | C25H31ClN2O4 |
|---|---|
| Molecular weight | 459.0 g/mol |
| IUPAC name | 4-[(2S,4S)-4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid;hydrochloride |
| InChIKey | SEZXOFFLNHXEJE-CQERKEQDSA-N |
| SMILES | CCO[C@H]1CCN([C@@H](C1)C2=CC=C(C=C2)C(=O)O)CC3=C(C=C(C4=C3C=CN4)C)OC.Cl |
Computed by PubChem (NCBI)