Products 1646534-47-5
CAS 1646534-47-5 is the registry number for 1,2,3,5-Tetrahydro-4,6,8-trimethyl-s-indacene, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
4,6,8-trimethyl-1,2,3,5-tetrahydro-s-indacene (CAS 1646534-47-5) is a chemical compound with the molecular formula C15H18 and a molecular weight of 198.30 g/mol. IUPAC name: 4,6,8-trimethyl-1,2,3,5-tetrahydro-s-indacene. InChIKey: GDIBBOILNGCJJH-UHFFFAOYSA-N.
| Molecular formula | C15H18 |
|---|---|
| Molecular weight | 198.30 g/mol |
| IUPAC name | 4,6,8-trimethyl-1,2,3,5-tetrahydro-s-indacene |
| InChIKey | GDIBBOILNGCJJH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)C(=C3CCCC3=C2C)C |
Computed by PubChem (NCBI)