Products 16469-85-5
CAS 16469-85-5 appears in our catalog under these names: 1,3-Dimethoxy-d6-benzene, 99 atom % D, min 98% Chemical Purity, 1，3–DIMETHOXY–D6–BENZENE, 1,3-Dimethoxybenzene-d6, 98.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 50 mg, 100 mg, 25 mg, 10 mg, 5 mg.
1,3-bis(trideuteriomethoxy)benzene (CAS 16469-85-5) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 144.20 g/mol. IUPAC name: 1,3-bis(trideuteriomethoxy)benzene. InChIKey: DPZNOMCNRMUKPS-WFGJKAKNSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 144.20 g/mol |
| IUPAC name | 1,3-bis(trideuteriomethoxy)benzene |
| InChIKey | DPZNOMCNRMUKPS-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC=C1)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)