Products 1648-99-3

CAS 1648-99-3 appears in our catalog under these names: 2,2,2-Trifluoroethanesulfonyl chloride, 95%, 2,2,2-Trifluoroethanesulfonyl chloride 95%, 2,2,2-TRIFLUOROETHANESULFONYL CHLORIDE,&, 2,2,2-TRIFLUOROETHANESULFONYL CHLORIDE,. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 2.5g, 10g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroethanesulfonyl chloride (CAS 1648-99-3) is a chemical compound with the molecular formula C2H2ClF3O2S and a molecular weight of 182.55 g/mol. IUPAC name: 2,2,2-trifluoroethanesulfonyl chloride. InChIKey: CXCHEKCRJQRVNG-UHFFFAOYSA-N.

Identity
Molecular formulaC2H2ClF3O2S
Molecular weight182.55 g/mol
IUPAC name2,2,2-trifluoroethanesulfonyl chloride
InChIKeyCXCHEKCRJQRVNG-UHFFFAOYSA-N
SMILESC(C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)