CAS 16484-16-5 is the registry number for 5-Iodo-1-phenyl-1H-tetrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-1-phenyltetrazole (CAS 16484-16-5) is a chemical compound with the molecular formula C7H5IN4 and a molecular weight of 272.05 g/mol. IUPAC name: 5-iodo-1-phenyltetrazole. InChIKey: SJIXMBBQRZPUMK-UHFFFAOYSA-N.
| Molecular formula | C7H5IN4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 5-iodo-1-phenyltetrazole |
| InChIKey | SJIXMBBQRZPUMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=N2)I |
Computed by PubChem (NCBI)