Products 164858-54-2
CAS 164858-54-2 appears in our catalog under these names: n-Undecane-d24, n-Undecane-d24, 98 atom % D, min 98% Chemical Purity, Undecane-d24. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 50 mg, 10 mg, 5 mg.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetracosadeuterioundecane (CAS 164858-54-2) is a chemical compound with the molecular formula C11H24 and a molecular weight of 180.46 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetracosadeuterioundecane. InChIKey: RSJKGSCJYJTIGS-XMTORAMYSA-N.
| Molecular formula | C11H24 |
|---|---|
| Molecular weight | 180.46 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tetracosadeuterioundecane |
| InChIKey | RSJKGSCJYJTIGS-XMTORAMYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)