CAS 16486-97-8 is the registry number for 1-Chloro-6-iodoperfluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodohexane (CAS 16486-97-8) is a chemical compound with the molecular formula C6ClF12I and a molecular weight of 462.40 g/mol. IUPAC name: 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodohexane. InChIKey: MKLCOZPKBKKNKG-UHFFFAOYSA-N.
| Molecular formula | C6ClF12I |
|---|---|
| Molecular weight | 462.40 g/mol |
| IUPAC name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-iodohexane |
| InChIKey | MKLCOZPKBKKNKG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)I)(F)F)(F)F)(C(C(F)(F)Cl)(F)F)(F)F |
Computed by PubChem (NCBI)