CAS 1648863-90-4 appears in our catalog under these names: G-5555/ 99.7% (existing batch purity), G–5555, G 5555, 99%, 99%, G-5555, 99.88%, G-5555, 99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
8-[(5-amino-1,3-dioxan-2-yl)methyl]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7-one (CAS 1648863-90-4) is a chemical compound with the molecular formula C25H25ClN6O3 and a molecular weight of 493.0 g/mol. IUPAC name: 8-[(5-amino-1,3-dioxan-2-yl)methyl]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7-one. InChIKey: ZBCMHWUFWQFPLV-UHFFFAOYSA-N.
| Molecular formula | C25H25ClN6O3 |
|---|---|
| Molecular weight | 493.0 g/mol |
| IUPAC name | 8-[(5-amino-1,3-dioxan-2-yl)methyl]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | ZBCMHWUFWQFPLV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=CC(=C(C=C2)C3=CC4=CN=C(N=C4N(C3=O)CC5OCC(CO5)N)NC)Cl |
Computed by PubChem (NCBI)