CAS 1648894-84-1 appears in our catalog under these names: 5–trans–17–phenyl trinor Prostaglandin F2α, 5-trans Bimatoprost Acid. Offered by: GLPBio, Chemat Brand. Available pack sizes: 1mg, on request, 5mg.
(E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid (CAS 1648894-84-1) is a chemical compound with the molecular formula C23H32O5 and a molecular weight of 388.5 g/mol. IUPAC name: (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid. InChIKey: YFHHIZGZVLHBQZ-UGYUJCRHSA-N.
| Molecular formula | C23H32O5 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid |
| InChIKey | YFHHIZGZVLHBQZ-UGYUJCRHSA-N |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H]1O)/C=C/[C@H](CCC2=CC=CC=C2)O)C/C=C/CCCC(=O)O)O |
Computed by PubChem (NCBI)